2-chloro-1-(chloromethyl)-3,4,5-trimethoxybenzene structure
|
Common Name | 2-chloro-1-(chloromethyl)-3,4,5-trimethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 848694-08-6 | Molecular Weight | 251.10600 | |
| Density | 1.249g/cm3 | Boiling Point | 323.475ºC at 760 mmHg | |
| Molecular Formula | C10H12Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.655ºC | |
| Name | 2-chloro-1-(chloromethyl)-3,4,5-trimethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 323.475ºC at 760 mmHg |
| Molecular Formula | C10H12Cl2O3 |
| Molecular Weight | 251.10600 |
| Flash Point | 120.655ºC |
| Exact Mass | 250.01600 |
| PSA | 27.69000 |
| LogP | 3.10460 |
| Index of Refraction | 1.518 |
| InChIKey | RYILSNRQSLTWPT-UHFFFAOYSA-N |
| SMILES | COc1cc(CCl)c(Cl)c(OC)c1OC |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Chloro-1-chloromethyl-3,4,5-trimethoxybenzene |