p-[[4-[(2-hydroxy-1-naphthyl)azo]phenyl]azo]benzenesulphonic acid, compound with 2-(dimethylamino)ethanol (1:1) structure
|
Common Name | p-[[4-[(2-hydroxy-1-naphthyl)azo]phenyl]azo]benzenesulphonic acid, compound with 2-(dimethylamino)ethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 84878-18-2 | Molecular Weight | 521.58800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H27N5O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(dimethylamino)ethanol,4-[[4-[(2Z)-2-(2-oxonaphthalen-1-ylidene)hydrazinyl]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H27N5O5S |
|---|---|
| Molecular Weight | 521.58800 |
| Exact Mass | 521.17300 |
| PSA | 152.40000 |
| LogP | 5.45490 |
| InChIKey | PTLHHVNDYMBFSC-UHFFFAOYSA-N |
| SMILES | CN(C)CCO.O=S(=O)(O)c1ccc(N=Nc2ccc(N=Nc3c(O)ccc4ccccc34)cc2)cc1 |
| einecs 284-408-6 |