Lup-20(29)-en-28-oic acid structure
|
Common Name | Lup-20(29)-en-28-oic acid | ||
|---|---|---|---|---|
| CAS Number | 848784-85-0 | Molecular Weight | 913.096 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 994.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C47H76O17 | Melting Point | 250-252 ºC | |
| MSDS | N/A | Flash Point | 284.3±27.8 °C | |
Use of Lup-20(29)-en-28-oic acidLup-20(29)-en-28-oic acid, a triterpenoid saponins of Pulsatilla koreana Root, possesses anti-inflammatory and anti-tumor effect[1][2]. |
| Name | Lup-20(29)-en-28-oic acid, 3-[(O-6-deoxy-α-L-mannopyranosyl-(1→2)-O-[β-D-glucopyranosyl-(1→4)]-α-L-arabinopyranosyl)oxy]-23-hydroxy-, (3β,4α) |
|---|---|
| Synonym | More Synonyms |
| Description | Lup-20(29)-en-28-oic acid, a triterpenoid saponins of Pulsatilla koreana Root, possesses anti-inflammatory and anti-tumor effect[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 994.3±65.0 °C at 760 mmHg |
| Melting Point | 250-252 ºC |
| Molecular Formula | C47H76O17 |
| Molecular Weight | 913.096 |
| Flash Point | 284.3±27.8 °C |
| Exact Mass | 912.508240 |
| PSA | 274.75000 |
| LogP | 5.66 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | XFCSYQCYIKSNBB-WZGBEVHGSA-N |
| SMILES | C=C(C)C1CCC2(C(=O)O)CCC3(C)C(CCC4C5(C)CCC(OC6OCC(OC7OC(CO)C(O)C(O)C7O)C(O)C6OC6OC(C)C(O)C(O)C6O)C(C)(CO)C5CCC43C)C12 |
| Water Solubility | Insuluble (1.8E-3 g/L) (25 ºC) |
|
Name: Cytotoxicity against human A549 cells after 48 hrs by SRB assay
Source: ChEMBL
Target: A549
External Id: CHEMBL973827
|
| (3β)-3-{[6-Deoxy-α-L-mannopyranosyl-(1->2)-[β-D-glucopyranosyl-(1->4)]-α-L-arabinopyranosyl]oxy}-23-hydroxylup-20(29)-en-28-oic acid |
| Pulsatilla saponin D |
| LUP-20(29)-EN-28-OIC ACID |
| Pulsatillasaponin D |
| Pulsatillasaponin |