2-((2'-Chloro-5'-(trifluoromethyl)phenoxy)methyl)phenylboronic acid(contains varying amounts of Anhydride) structure
|
Common Name | 2-((2'-Chloro-5'-(trifluoromethyl)phenoxy)methyl)phenylboronic acid(contains varying amounts of Anhydride) | ||
|---|---|---|---|---|
| CAS Number | 849062-11-9 | Molecular Weight | 330.49500 | |
| Density | 1.42g/cm3 | Boiling Point | 451.6ºC at 760 mmHg | |
| Molecular Formula | C14H11BClF3O3 | Melting Point | 138-147ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 226.9ºC | |
| Name | (2-((2-Chloro-5-(trifluoromethyl)phenoxy)methyl)phenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 451.6ºC at 760 mmHg |
| Melting Point | 138-147ºC(lit.) |
| Molecular Formula | C14H11BClF3O3 |
| Molecular Weight | 330.49500 |
| Flash Point | 226.9ºC |
| Exact Mass | 330.04400 |
| PSA | 49.69000 |
| LogP | 2.61760 |
| Index of Refraction | 1.552 |
| InChIKey | DNZSKCIEUYUZRA-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccccc1COc1cc(C(F)(F)F)ccc1Cl |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [2-[[2-chloro-5-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid |