(3-Bromo-2-((3-bromobenzyl)oxy)phenyl)boronic acid structure
|
Common Name | (3-Bromo-2-((3-bromobenzyl)oxy)phenyl)boronic acid | ||
|---|---|---|---|---|
| CAS Number | 849062-27-7 | Molecular Weight | 385.84400 | |
| Density | 1.79g/cm3 | Boiling Point | 520.5ºC at 760 mmHg | |
| Molecular Formula | C13H11BBr2O3 | Melting Point | 107-112ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 268.6ºC | |
| Name | (3-Bromo-2-((3-bromobenzyl)oxy)phenyl)boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 520.5ºC at 760 mmHg |
| Melting Point | 107-112ºC(lit.) |
| Molecular Formula | C13H11BBr2O3 |
| Molecular Weight | 385.84400 |
| Flash Point | 268.6ºC |
| Exact Mass | 383.91700 |
| PSA | 49.69000 |
| LogP | 2.47040 |
| Index of Refraction | 1.662 |
| InChIKey | JWOHGYXQGYSJMX-UHFFFAOYSA-N |
| SMILES | OB(O)c1cccc(Br)c1OCc1cccc(Br)c1 |
| Hazard Statements | H413 |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [3-bromo-2-[(3-bromophenyl)methoxy]phenyl]boronic acid |