3-BROMO-2-(4'-FLUOROBENZYLOXY)-5-METHYL& structure
|
Common Name | 3-BROMO-2-(4'-FLUOROBENZYLOXY)-5-METHYL& | ||
|---|---|---|---|---|
| CAS Number | 849062-41-5 | Molecular Weight | 338.96500 | |
| Density | 1.51g/cm3 | Boiling Point | 494.4ºC at 760 mmHg | |
| Molecular Formula | C14H13BBrFO3 | Melting Point | 128-133ºC(lit.) | |
| MSDS | USA | Flash Point | 252.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [3-bromo-2-[(4-fluorophenyl)methoxy]-5-methylphenyl]boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 494.4ºC at 760 mmHg |
| Melting Point | 128-133ºC(lit.) |
| Molecular Formula | C14H13BBrFO3 |
| Molecular Weight | 338.96500 |
| Flash Point | 252.8ºC |
| Exact Mass | 338.01300 |
| PSA | 49.69000 |
| LogP | 2.15540 |
| Index of Refraction | 1.605 |
| InChIKey | PMGXFVHJKMZADN-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)c(OCc2ccc(F)cc2)c(B(O)O)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H413 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD06411360 |