2-Acetyl-4-chloro-6-nitrophenol structure
|
Common Name | 2-Acetyl-4-chloro-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 84942-40-5 | Molecular Weight | 215.590 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 260.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H6ClNO4 | Melting Point | 132-135ºC | |
| MSDS | Chinese USA | Flash Point | 111.5±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 260.7±40.0 °C at 760 mmHg |
| Melting Point | 132-135ºC |
| Molecular Formula | C8H6ClNO4 |
| Molecular Weight | 215.590 |
| Flash Point | 111.5±27.3 °C |
| Exact Mass | 214.998535 |
| PSA | 83.12000 |
| LogP | 3.57 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | IUNBIQBAYUBIFD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Cl)cc([N+](=O)[O-])c1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
|
~98%
2-Acetyl-4-chlo... CAS#:84942-40-5 |
| Literature: Burdeska, K. Synthesis, 1982 , # 11 p. 940 - 942 |
|
~%
2-Acetyl-4-chlo... CAS#:84942-40-5 |
| Literature: Oriental Journal of Chemistry, , vol. 27, # 3 p. 1053 - 1062 |
|
~%
2-Acetyl-4-chlo... CAS#:84942-40-5 |
| Literature: Oriental Journal of Chemistry, , vol. 27, # 3 p. 1053 - 1062 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
6-Chloro-8-nitro-4-oxo-4H-chromene-3-carbaldehyde.
Acta Crystallogr. Sect. E Struct. Rep. Online 70(Pt 5) , o547, (2014) In the title compound, C10H4ClNO5, the non-H atoms of the 6-chloro-chromone unit are coplanar (r.m.s. deviation = 0.017 Å) with the largest deviation from the mean plane [0.031 (2) Å] being found for ... |
|
|
Phase transition and intramolecular hydrogen bonding in nitro derivatives of ortho-hydroxy acetophenones Filarowski, A., et al.
J. Mol. Struct. 785(1) , 7-13, (2006)
|
| 1-(5-Chloro-2-hydroxy-3-nitrophenyl)ethanone |
| MFCD01631131 |
| 2-HYDROXY-3-NITROACETOPHENONE |
| 5'-CHLORO-2'-HYDROXY-3'-NITROACETOPHE |
| 1-acetyl-5-chloro-2-hydroxy-3-nitrobenzene |
| Ethanone, 1-(5-chloro-2-hydroxy-3-nitrophenyl)- |
| 2-Acetyl-6-nitro-4-chloro phenol |
| 2'-HYDROXY-3'-NITRO-5'-CHLORO ACETOPHENONE |
| 1-(5-CHLORO-2-HYDROXY-3-NITRO-PHENYL)ETHANONE |
| 5-Chloro-2-Hydroxy-3-Nitroacetophenone |
| 5-CHLORO -3-NITRO-2-HYDROXY ACETOPHENONE |
| 2-ACETYL-6-NITRO-4-CHLOROPHENOL |
| 5'-Chloro-2'-hydroxy-3'-nitroacetophenone |
| 2-Acetyl-4-chloro-6-nitrophenol |