TMPH hydrochloride structure
|
Common Name | TMPH hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 849461-91-2 | Molecular Weight | 305.88 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H32ClNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of TMPH hydrochloridenAChR-IN-1 (hydrochloride) is a tetramethylpiperidine heptanoate, a selective nicotinic acetylcholine receptor (nAChR) inhibitor that inhibits nAChRs lacking α5, α6, or β3 subunits. nAChR-IN-1 has the effect of preventing nerve disorder, can be used for nicotinic acetylcholine receptor dysfunction or neurological disorders research[1]. |
| Name | 2,2,6,6-Tetramethyl-4-piperidinyl heptanoate hydrochloride (1:1) |
|---|
| Description | nAChR-IN-1 (hydrochloride) is a tetramethylpiperidine heptanoate, a selective nicotinic acetylcholine receptor (nAChR) inhibitor that inhibits nAChRs lacking α5, α6, or β3 subunits. nAChR-IN-1 has the effect of preventing nerve disorder, can be used for nicotinic acetylcholine receptor dysfunction or neurological disorders research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H32ClNO2 |
|---|---|
| Molecular Weight | 305.88 |
| Exact Mass | 305.21200 |
| PSA | 38.33000 |
| LogP | 4.94000 |
| InChIKey | XIDDVJIJIFWGIX-UHFFFAOYSA-N |
| SMILES | CCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1.Cl |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RIDADR | NONH for all modes of transport |
|
Levamisole-induced reduction in seizure threshold: a possible role of nicotinic acetylcholine receptor-mediated pathway.
Naunyn Schmiedebergs Arch. Pharmacol. 382(3) , 279-85, (2010) Levamisole produces seizures in man and is also known to activate the neuronal nicotinic acetylcholine receptors, which are further known to elicit seizure activity. Therefore, the present study has b... |