Josiphos SL-J452-1 structure
|
Common Name | Josiphos SL-J452-1 | ||
|---|---|---|---|---|
| CAS Number | 849924-73-8 | Molecular Weight | 590.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H32FeO2P2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 1,2,3,4,5-Cyclopentanepentayl, compd. with 1-[(1S)-1-[bis(2-methy lphenyl)phosphino]ethyl]-2-(di-2-furanylphosphino)-1,2,3,4,5-cycl opentanepentayl, iron salt (1:1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H32FeO2P2 |
|---|---|
| Molecular Weight | 590.40900 |
| Exact Mass | 590.12300 |
| PSA | 53.46000 |
| LogP | 7.78590 |
| InChIKey | SPAUEXSFJREZBQ-IFUPQEAVSA-N |
| SMILES | Cc1ccccc1P(c1ccccc1C)C(C)[C]1[CH][CH][CH][C]1P(c1ccco1)c1ccco1.[CH]1[CH][CH][CH][CH]1.[Fe] |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29321900 |
| MFCD08561168 |