Josiphos SL-J013-1 structure
|
Common Name | Josiphos SL-J013-1 | ||
|---|---|---|---|---|
| CAS Number | 187733-50-2 | Molecular Weight | 658.61100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H52FeO2P2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | 1,2,3,4,5-Cyclopentanepentayl, compd. with 1-[(1S)-1-[bis(1,1-dim ethylethyl)phosphino]ethyl]-2-[bis(4-methoxy-3,5-dimethylphenyl)p hosphino]-1,2,3,4,5-cyclopentanepentayl, iron salt (1:1:1) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C38H52FeO2P2 |
|---|---|
| Molecular Weight | 658.61100 |
| Exact Mass | 658.27900 |
| PSA | 45.64000 |
| LogP | 10.17990 |
| InChIKey | UALLLNAXGQTBJA-WLOLSGMKSA-N |
| SMILES | COc1c(C)cc(P([C]2[CH][CH][CH][C]2C(C)P(C(C)(C)C)C(C)(C)C)c2cc(C)c(OC)c(C)c2)cc1C.[CH]1[CH][CH][CH][CH]1.[Fe] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29319090 |
| MFCD08561156 |