1-boc-3-bromopiperidine structure
|
Common Name | 1-boc-3-bromopiperidine | ||
|---|---|---|---|---|
| CAS Number | 849928-26-3 | Molecular Weight | 264.159 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 296.6±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H18BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.2±25.4 °C | |
| Name | tert-butyl 3-bromopiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.6±33.0 °C at 760 mmHg |
| Molecular Formula | C10H18BrNO2 |
| Molecular Weight | 264.159 |
| Flash Point | 133.2±25.4 °C |
| Exact Mass | 263.052094 |
| PSA | 29.54000 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | YCUDHDNCZHPAJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Br)C1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 3-bromo-, 1,1-dimethylethyl ester |
| HT922 |
| 2-Methyl-2-propanyl 3-bromo-1-piperidinecarboxylate |
| tert-Butyl 3-bromopiperidine-1-carboxylate |
| 3-Bromo-piperidine-1-carboxylic acid tert-butyl ester |
| 1-N-BOC-3-BROMOPIPERIDINE |
| 1-Boc-3-bromopiperidine |