tert-Butyl 4-oxo-2-phenylpiperidine-1-carboxylate structure
|
Common Name | tert-Butyl 4-oxo-2-phenylpiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 849928-30-9 | Molecular Weight | 275.343 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 400.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.2±28.7 °C | |
| Name | tert-butyl 4-oxo-2-phenylpiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 400.8±45.0 °C at 760 mmHg |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.343 |
| Flash Point | 196.2±28.7 °C |
| Exact Mass | 275.152130 |
| PSA | 46.61000 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | UMUHNUZMXNXCMV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)CC1c1ccccc1 |
| Safety Phrases | 24/25 |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| t-butyl 2-phenyl-4-oxopiperidine-1-carboxylate |
| 1-Piperidinecarboxylic acid, 4-oxo-2-phenyl-, 1,1-dimethylethyl ester |
| 1-Boc-2-phenyl-4-piperidinone |
| MFCD04035609 |
| RW2879 |
| tert-Butyl 4-oxo-2-phenylpiperidine-1-carboxylate |
| 1-Boc-2-phenyl-piperidin-4-one |
| 2-Methyl-2-propanyl 4-oxo-2-phenyl-1-piperidinecarboxylate |