2-(4-Chlorobenzoyl)benzoic acid structure
|
Common Name | 2-(4-Chlorobenzoyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 85-56-3 | Molecular Weight | 260.67200 | |
| Density | 1.357 g/cm3 | Boiling Point | 470.8ºC at 760 mmHg | |
| Molecular Formula | C14H9ClO3 | Melting Point | 149-150 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 238.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-Chlorobenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357 g/cm3 |
|---|---|
| Boiling Point | 470.8ºC at 760 mmHg |
| Melting Point | 149-150 °C(lit.) |
| Molecular Formula | C14H9ClO3 |
| Molecular Weight | 260.67200 |
| Flash Point | 238.5ºC |
| Exact Mass | 260.02400 |
| PSA | 54.37000 |
| LogP | 3.26920 |
| Index of Refraction | 1.624 |
| InChIKey | YWECCEXWKFHHQJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(=O)c1ccc(Cl)cc1 |
| Storage condition | Refrigerator |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
[Study on photoluminescence of 2-(4-chloro-benzoyl)benzoic acid complexes].
Guang Pu Xue Yu Guang Pu Fen Xi 29(11) , 2904-8, (2009) Eight complexes of europium and terbium were synthesized, with 2-(4-chloro-benzoyl)benzoic acid as an essential ligand and other three distinct ligands, including 1, 10-phenanthroline, triphenylphosph... |
|
|
Synthesis and characterization of Phthalazinone containing Poly (arylene ether) s, Poly (arylene thioether) s, and Poly (arylene sulfone) s via a novel NC coupling reaction. Wang SJ, et al.
Macromolecules 37(1) , 60-65, (2004)
|
| p-Chlorobenzoylbenzoic acid |
| MFCD00002474 |
| EINECS 201-615-9 |