methyl 2-(2-ethyl-1-oxobutoxy)benzoate structure
|
Common Name | methyl 2-(2-ethyl-1-oxobutoxy)benzoate | ||
|---|---|---|---|---|
| CAS Number | 85005-92-1 | Molecular Weight | 250.29000 | |
| Density | 1.081g/cm3 | Boiling Point | 317.4ºC at 760 mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.5ºC | |
| Name | methyl 2-(2-ethylbutanoyloxy)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Boiling Point | 317.4ºC at 760 mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29000 |
| Flash Point | 149.5ºC |
| Exact Mass | 250.12100 |
| PSA | 52.60000 |
| LogP | 2.81480 |
| Index of Refraction | 1.498 |
| InChIKey | QXNXIPALJCPMNY-UHFFFAOYSA-N |
| SMILES | CCC(CC)C(=O)Oc1ccccc1C(=O)OC |
| HS Code | 2918990090 |
|---|
|
~%
methyl 2-(2-eth... CAS#:85005-92-1 |
| Literature: Kaufmann Patent: DE623596 , 1933 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 22, p. 719 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 285-023-6 |
| 2-(2-ethyl-butyryloxy)-benzoic acid methyl ester |
| 2-(2-Aethyl-butyryloxy)-benzoesaeure-methylester |
| methyl 2-(2-ethyl-1-oxobutoxy)benzoate |