2c-t-7 structure
|
Common Name | 2c-t-7 | ||
|---|---|---|---|---|
| CAS Number | 850140-15-7 | Molecular Weight | 291.837 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 2℃ | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
Use of 2c-t-7C-T-7 is a 2,5-dimethoxy phenethylamine with a propylthio group in the 4 position. |
| Name | 2-(2,5-dimethoxy-4-propylsulfanylphenyl)ethanamine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22ClNO2S |
|---|---|
| Molecular Weight | 291.837 |
| Flash Point | 2℃ |
| Exact Mass | 291.105988 |
| PSA | 69.78000 |
| LogP | 4.20940 |
| InChIKey | AHZKNSBEESCMGM-UHFFFAOYSA-N |
| SMILES | CCCSc1cc(OC)c(CCN)cc1OC.Cl |
| Storage condition | ?20°C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H332-H319 |
| Precautionary Statements | P210-P305 + P351 + P338 |
| Hazard Codes | F,Xn |
| Risk Phrases | 11-20/21/22-36 |
| Safety Phrases | 16-26-36/37 |
| RIDADR | UN 1648 3 / PGII |
| 2,4-dihydroxypyrimidine-5-carbonitrile |
| Benzeneethanamine, 2,5-dimethoxy-4-(propylthio)-, hydrochloride (1:1) |
| 2-[2,5-Dimethoxy-4-(propylsulfanyl)phenyl]ethanamine hydrochloride (1:1) |
| 2,5-dimethoxy-4-(propylsulfanyl)phenethylamine hydrochloride |