N-Benzyl-2-bromo-N-phenylbutanamide structure
|
Common Name | N-Benzyl-2-bromo-N-phenylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 851073-30-8 | Molecular Weight | 332.23500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18BrNO | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | N-Benzyl-2-bromo-N-phenylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18BrNO |
|---|---|
| Molecular Weight | 332.23500 |
| Exact Mass | 331.05700 |
| PSA | 20.31000 |
| LogP | 4.39330 |
| InChIKey | DVAAHBQCAZCHOP-UHFFFAOYSA-N |
| SMILES | CCC(Br)C(=O)N(Cc1ccccc1)c1ccccc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H410 |
| Precautionary Statements | P273-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2924299090 |
| Flash Point(F) | >230 °F |
| Flash Point(C) | >110 °C |
|
~%
N-Benzyl-2-brom... CAS#:851073-30-8 |
| Literature: Fischer, Christian; Fu, Gregory C. Journal of the American Chemical Society, 2005 , vol. 127, # 13 p. 4594 - 4595 |
|
~%
N-Benzyl-2-brom... CAS#:851073-30-8 |
| Literature: Bischoff Chemische Berichte, 1898 , vol. 31, p. 2674 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Asymmetric nickel-catalyzed Negishi cross-couplings of secondary alpha-bromo amides with organozinc reagents.
J. Am. Chem. Soc. 127 , 4594, (2005) A Ni/Pybox catalyst achieves the asymmetric cross-coupling of secondary alpha-bromo amides with organozinc reagents. The process tolerates a variety of functional groups and affords the desired produc... |
| 2-bromo-butyric acid-(N-benzyl-anilide) |
| 2-bromo-N-phenyl-N-(phenylmethyl)-butanamide |
| N-benzyl-N-phenyl-2-bromobutanamide |
| 2-Brom-buttersaeure-(N-benzyl-anilid) |