4-Ethoxy-1,2-benzenediamine sulfate (1:1) structure
|
Common Name | 4-Ethoxy-1,2-benzenediamine sulfate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 85137-09-3 | Molecular Weight | 250.272 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Ethoxybenzene-1,2-diamine sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H14N2O5S |
|---|---|
| Molecular Weight | 250.272 |
| Exact Mass | 250.062347 |
| PSA | 144.25000 |
| LogP | 2.84010 |
| InChIKey | AOWLQOMCVRWFEA-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N)c(N)c1.O=S(=O)(O)O |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | 20/21/22-40-43-50/53-68 |
| Safety Phrases | 36/37-45-60-61 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-ethoxybenzene-1,2-diamine,sulfuric acid |
| 4-Ethoxybenzene-1,2-diamine sulfate (1:1) |
| 4-Ethoxy-1,2-benzenediamine sulfate (1:1) |
| 1,2-Benzenediamine, 4-ethoxy-, sulfate (1:1) |
| MFCD00640896 |
| EINECS 214-825-0 |