1-(4-HYDROXYPHENYL)-5-METHYLPYRIDIN-2(1H)-ONE structure
|
Common Name | 1-(4-HYDROXYPHENYL)-5-METHYLPYRIDIN-2(1H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 851518-71-3 | Molecular Weight | 201.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11NO2 | Melting Point | 161-162 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1-(4-HYDROXYPHENYL)-5-METHYLPYRIDIN-2(1H)-ONEHydronidone is a pyridine derivative and an antifibrotic agent for hepatic fibrosis[1]. |
| Name | 1-(4-hydroxyphenyl)-5-methylpyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Hydronidone is a pyridine derivative and an antifibrotic agent for hepatic fibrosis[1]. |
|---|---|
| References |
| Melting Point | 161-162 °C |
|---|---|
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22100 |
| Exact Mass | 201.07900 |
| PSA | 42.23000 |
| LogP | 1.85150 |
| InChIKey | NETTXQJYJRFTFS-UHFFFAOYSA-N |
| SMILES | Cc1ccc(=O)n(-c2ccc(O)cc2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD07369446 |