Ethyl 2,2,4-trichloro-3-oxo-butanoate
Modify Date: 2025-09-11 11:09:05
Ethyl 2,2,4-trichloro-3-oxo-butanoate structure
|
Common Name | Ethyl 2,2,4-trichloro-3-oxo-butanoate | ||
|---|---|---|---|---|
| CAS Number | 85153-67-9 | Molecular Weight | 233.47700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2,2,4-trichloro-3-oxo-butanoate |
|---|
| Molecular Formula | C6H7Cl3O3 |
|---|---|
| Molecular Weight | 233.47700 |
| Exact Mass | 231.94600 |
| PSA | 43.37000 |
| LogP | 1.53130 |
| InChIKey | HWNQMVWBWPURQG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cl)(Cl)C(=O)CCl |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |