Cysmethynil structure
|
Common Name | Cysmethynil | ||
|---|---|---|---|---|
| CAS Number | 851636-83-4 | Molecular Weight | 376.53400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CysmethynilCysmethynil is an Icmt inhibitor(IC50 = 2.4 μM). Cysmethynil inhibites RAS membrane binding and EGF signal transduction. Cysmethynil prevents the cells in the G1 phase and induces autophagy. Cysmethynil inhibits PC3 cells proliferation, has synergistic effect with Paclitaxel (HY-B0015) and Doxorubicin (HY-15142A). Cysmethynil has anti-tumor effects and can be used for solid tumor (such as prostate cancer et al.) research[1][2][3]. |
| Name | 2-[5-(3-methylphenyl)-1-octylindol-3-yl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | Cysmethynil is an Icmt inhibitor(IC50 = 2.4 μM). Cysmethynil inhibites RAS membrane binding and EGF signal transduction. Cysmethynil prevents the cells in the G1 phase and induces autophagy. Cysmethynil inhibits PC3 cells proliferation, has synergistic effect with Paclitaxel (HY-B0015) and Doxorubicin (HY-15142A). Cysmethynil has anti-tumor effects and can be used for solid tumor (such as prostate cancer et al.) research[1][2][3]. |
|---|---|
| Related Catalog | |
| Target |
IC50 = 2.4 μM for Icmt |
| References |
| Molecular Formula | C25H32N2O |
|---|---|
| Molecular Weight | 376.53400 |
| Exact Mass | 376.25100 |
| PSA | 49.01000 |
| LogP | 7.15470 |
| InChIKey | QIXBOOVPFRZHQQ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCn1cc(CC(N)=O)c2cc(-c3cccc(C)c3)ccc21 |
| 9J20 |
| 1H-Indole-3-acetamide, 5-(3-methylphenyl)-1-octyl- |
| 2-[5-(3-Methylphenyl)-1-octyl-1H-indol-3-yl]acetamide |
| Cysmethynil |
| 1H-Indole-3-acetamide,5-(3-methylphenyl)-1-octyl |