Pregn-5-ene-20-carboxamide,3-(acetyloxy)-, (3b,20S)- (9CI) structure
|
Common Name | Pregn-5-ene-20-carboxamide,3-(acetyloxy)-, (3b,20S)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 85179-02-8 | Molecular Weight | 387.55500 | |
| Density | 1.11g/cm3 | Boiling Point | 529.4ºC at 760 mmHg | |
| Molecular Formula | C24H37NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.5ºC | |
| Name | [17-(1-amino-1-oxopropan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 529.4ºC at 760 mmHg |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.55500 |
| Flash Point | 164.5ºC |
| Exact Mass | 387.27700 |
| PSA | 69.39000 |
| LogP | 5.31880 |
| Index of Refraction | 1.545 |
| InChIKey | SPJJQKMRGHDHDW-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)C(N)=O)CCC32)C1 |
|
~%
Pregn-5-ene-20-... CAS#:85179-02-8 |
| Literature: Cole; Julian Journal of the American Chemical Society, 1945 , vol. 67, p. 1369,1372 |
|
~%
Pregn-5-ene-20-... CAS#:85179-02-8 |
| Literature: Wasserman,H.H.; Wharton,P.S. Journal of the American Chemical Society, 1960 , vol. 82, p. 661 - 665 |
|
~%
Pregn-5-ene-20-... CAS#:85179-02-8 |
| Literature: Cole; Julian Journal of the American Chemical Society, 1945 , vol. 67, p. 1369,1372 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |