1-Fluoro-2-methyl-3,5-dinitrobenzene structure
|
Common Name | 1-Fluoro-2-methyl-3,5-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 85233-16-5 | Molecular Weight | 200.124 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 303.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5FN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.2±26.5 °C | |
| Name | 1-fluoro-2-methyl-3,5-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.3±37.0 °C at 760 mmHg |
| Molecular Formula | C7H5FN2O4 |
| Molecular Weight | 200.124 |
| Flash Point | 137.2±26.5 °C |
| Exact Mass | 200.023331 |
| PSA | 91.64000 |
| LogP | 1.93 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | JZFYAALVLGWFKH-UHFFFAOYSA-N |
| SMILES | Cc1c(F)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~10%
1-Fluoro-2-meth... CAS#:85233-16-5 |
| Literature: Chambers, Richard D.; Fox, Mark A.; Sandford, Graham; Trmcic, Jelena; Goeta, Andres Journal of Fluorine Chemistry, 2007 , vol. 128, # 1 p. 29 - 33 |
| Benzene, 1-fluoro-2-methyl-3,5-dinitro- |
| 2,4-Dinitro-6-fluor-toluol |
| 2,4-DINITRO-6-FLUOROTOLUENE |
| 1-fluoranyl-2-methyl-3,5-dinitro-benzene |
| Benzene,1-fluoro-2-methyl-3,5-dinitro |
| 1-Fluoro-2-methyl-3,5-dinitrobenzene |