1-Bromo-2-methyl-3,5-dinitrobenzene structure
|
Common Name | 1-Bromo-2-methyl-3,5-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 18242-38-1 | Molecular Weight | 261.030 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 331.2±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H5BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.1±26.5 °C | |
| Name | 1-bromo-2-methyl-3,5-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 331.2±37.0 °C at 760 mmHg |
| Molecular Formula | C7H5BrN2O4 |
| Molecular Weight | 261.030 |
| Flash Point | 154.1±26.5 °C |
| Exact Mass | 259.943268 |
| PSA | 91.64000 |
| LogP | 2.46 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | VPCDPLZDNORAKR-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
|
~99%
1-Bromo-2-methy... CAS#:18242-38-1 |
| Literature: Kim, Mi Kyoung; Shin, Heerim; Cho, Seo Young; Chong, Youhoon Bioorganic and Medicinal Chemistry, 2014 , vol. 22, # 3 p. 1156 - 1162 |
|
~93%
1-Bromo-2-methy... CAS#:18242-38-1 |
| Literature: Melhuish, Martin W.; Moodie, Roy B. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1989 , p. 667 - 674 |
|
~9%
1-Bromo-2-methy... CAS#:18242-38-1 |
| Literature: Melhuish, Martin W.; Moodie, Roy B. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1989 , p. 667 - 674 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 1-bromo-2-methyl-3,5-dinitro- |
| 6-bromo-2,4-dinitrotoluene |
| 2-Brom-4,6-dinitro-toluol |
| 1-Bromo-2-methyl-3,5-dinitrobenzene |
| 6-Brom-2,4-dinitro-toluol |
| 2-Bromo-4,6-dinitrotoluol |
| 2-bromo-4,6-dinitrotoluene |
| 3-bromo-2-methyl-1,5-dinitrobenzene |