N-Succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate structure
|
Common Name | N-Succinimidyl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate | ||
|---|---|---|---|---|
| CAS Number | 852527-45-8 | Molecular Weight | 589.20100 | |
| Density | 1.658g/cm3 | Boiling Point | 330.5ºC at 760 mmHg | |
| Molecular Formula | C15H8F17NO4 | Melting Point | 140-146°C | |
| MSDS | Chinese USA | Flash Point | 153.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2,5-dioxopyrrolidin-1-yl) 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.658g/cm3 |
|---|---|
| Boiling Point | 330.5ºC at 760 mmHg |
| Melting Point | 140-146°C |
| Molecular Formula | C15H8F17NO4 |
| Molecular Weight | 589.20100 |
| Flash Point | 153.7ºC |
| Exact Mass | 589.01800 |
| PSA | 63.68000 |
| LogP | 5.32110 |
| Index of Refraction | 1.356 |
| InChIKey | PFSIGNUPTCQGSG-UHFFFAOYSA-N |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)ON1C(=O)CCC1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
~42%
N-Succinimidyl ... CAS#:852527-45-8 |
| Literature: Malik, Leila; Nygaard, Jesper; Hoiberg-Nielsen, Rasmus; Arleth, Lise; Hoeg-Jensen, Thomas; Jensen, Knud J. Langmuir, 2012 , vol. 28, # 1 p. 593 - 603 |
| 2,5-dioxopyrrolidine-1-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecanoate |