WAY-656935 structure
|
Common Name | WAY-656935 | ||
|---|---|---|---|---|
| CAS Number | 852902-81-9 | Molecular Weight | 425.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15ClN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-656935ROCK Inhibitor; inhibitor of ROCK, ERK, GSK, and AGC protein kinases; |
| Name | WAY-656935 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15ClN3O2S |
|---|---|
| Molecular Weight | 425.97 |
| InChIKey | KRTWQGKOABBBLA-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(NC(=O)CNC23CC4CC(CC(C4)C2)C3)c1 |
| Acetamide, N-[2-chloro-5-[(dimethylamino)sulfonyl]phenyl]-2-(tricyclo[3.3.1.13,7]dec-1-ylamino)- |