WAY-657021
Modify Date: 2025-09-18 10:48:58
WAY-657021 structure
|
Common Name | WAY-657021 | ||
|---|---|---|---|---|
| CAS Number | 852906-23-1 | Molecular Weight | 264.23 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-657021fungicidal and bactericidal activities |
| Name | WAY-657021 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.23 |
| Exact Mass | 384.173218 |
| LogP | 3.21 |
| Index of Refraction | 1.679 |
| InChIKey | SUORWAWRONKXIT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nnc(SC(C)C(=O)NC3(C#N)CCCCC3)n2N)cc1 |
| 2-{[4-Amino-5-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-N-(1-cyanocyclohexyl)propanamide |
| Propanamide, 2-[[4-amino-5-(4-methylphenyl)-4H-1,2,4-triazol-3-yl]thio]-N-(1-cyanocyclohexyl)- |