3-(5-(2-(TRIFLUOROMETHYL)PHENYL)FURAN-2& structure
|
Common Name | 3-(5-(2-(TRIFLUOROMETHYL)PHENYL)FURAN-2& | ||
|---|---|---|---|---|
| CAS Number | 853310-21-1 | Molecular Weight | 284.23100 | |
| Density | 1.322g/cm3 | Boiling Point | 377.2ºC at 760 mmHg | |
| Molecular Formula | C14H11F3O3 | Melting Point | 69-73ºC | |
| MSDS | Chinese USA | Flash Point | 181.9ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 3-[5-[2-(trifluoromethyl)phenyl]furan-2-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.322g/cm3 |
|---|---|
| Boiling Point | 377.2ºC at 760 mmHg |
| Melting Point | 69-73ºC |
| Molecular Formula | C14H11F3O3 |
| Molecular Weight | 284.23100 |
| Flash Point | 181.9ºC |
| Exact Mass | 284.06600 |
| PSA | 50.44000 |
| LogP | 3.98260 |
| Index of Refraction | 1.506 |
| InChIKey | GUNVLEJSOWBDBS-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc(-c2ccccc2C(F)(F)F)o1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | 25-36/37/38 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-(5-(2-(Trifluoromethyl)phenyl)furan-2-yl)propionic acid |