(+)-1,4-BIS-O-(4-CHLOROBENZYL)-D-THREITOL structure
|
Common Name | (+)-1,4-BIS-O-(4-CHLOROBENZYL)-D-THREITOL | ||
|---|---|---|---|---|
| CAS Number | 85362-86-3 | Molecular Weight | 371.25500 | |
| Density | 1.319g/cm3 | Boiling Point | 535.045ºC at 760 mmHg | |
| Molecular Formula | C18H20Cl2O4 | Melting Point | 72-74ºC | |
| MSDS | N/A | Flash Point | 277.385ºC | |
| Name | (2R,3R)-1,4-bis[(4-chlorophenyl)methoxy]butane-2,3-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 535.045ºC at 760 mmHg |
| Melting Point | 72-74ºC |
| Molecular Formula | C18H20Cl2O4 |
| Molecular Weight | 371.25500 |
| Flash Point | 277.385ºC |
| Exact Mass | 370.07400 |
| PSA | 58.92000 |
| LogP | 3.44860 |
| Index of Refraction | 1.591 |
| InChIKey | MBGYQXOSGYFFSY-QZTJIDSGSA-N |
| SMILES | OC(COCc1ccc(Cl)cc1)C(O)COCc1ccc(Cl)cc1 |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2909499000 |
|
~90%
(+)-1,4-BIS-O-(... CAS#:85362-86-3 |
| Literature: Tamoto; Sugimori; Terashima Tetrahedron, 1984 , vol. 40, # 22 p. 4617 - 4623 |
|
~75%
(+)-1,4-BIS-O-(... CAS#:85362-86-3 |
| Literature: Tamoto; Sugimori; Terashima Tetrahedron, 1984 , vol. 40, # 22 p. 4617 - 4623 |
|
~%
(+)-1,4-BIS-O-(... CAS#:85362-86-3 |
| Literature: Tamoto; Sugimori; Terashima Tetrahedron, 1984 , vol. 40, # 22 p. 4617 - 4623 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| (R,R)-(+)-1,4-Bis(4-chlorobenzyloxy)-2,3-butanediol |
| (+)-1,4-Bis-O-(4-chlorobenzyl)-D-threitol |
| (2R,3R)-(+)-1,4-bis(4-chlorobenzyloxy)butane-2,3-diol |