bis[2-(p-nitrophenyl)ethyl] phosphorochloridate structure
|
Common Name | bis[2-(p-nitrophenyl)ethyl] phosphorochloridate | ||
|---|---|---|---|---|
| CAS Number | 85363-77-5 | Molecular Weight | 414.73400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16ClN2O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis[2-(p-nitrophenyl)ethyl] phosphorochloridate |
|---|
| Molecular Formula | C16H16ClN2O7P |
|---|---|
| Molecular Weight | 414.73400 |
| Exact Mass | 414.03800 |
| PSA | 136.98000 |
| LogP | 5.71470 |
| InChIKey | JCTAVWAUACBZKP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CCOP(=O)(Cl)OCCc2ccc([N+](=O)[O-])cc2)cc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-27-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| Packaging Group | III |
| HS Code | 2931900090 |
|
~99%
bis[2-(p-nitrop... CAS#:85363-77-5 |
| Literature: Himmelsbach, Frank; Charubala, Ramamurthy; Pfleiderer, Wolfgang Helvetica Chimica Acta, 1987 , vol. 70, p. 1286 - 1295 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |