WAY-323260 structure
|
Common Name | WAY-323260 | ||
|---|---|---|---|---|
| CAS Number | 853710-07-3 | Molecular Weight | 378.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-323260lipoprotein oxidation inhibitor (useful for treatment of neurological conditions) |
| Name | WAY-323260 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H30N4O |
|---|---|
| Molecular Weight | 378.5 |
| InChIKey | WEHJWORIYSUYAQ-UHFFFAOYSA-N |
| SMILES | CCCN1CCN(CC(=O)Nc2ccc3c(c2)c2ccccc2n3CC)CC1 |
| 1-Piperazineacetamide, N-(9-ethyl-9H-carbazol-3-yl)-4-propyl- |