LY303511 (hydrochloride) structure
|
Common Name | LY303511 (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 854127-90-5 | Molecular Weight | 379.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LY303511 (hydrochloride)LY303511 is a close structural analog of LY294002 , a selective phosphatidylinositol 3-kinase (PI3K) inhibitor |
| Name | 8-phenyl-2-piperazin-1-ylchromen-4-one,dihydrochloride |
|---|
| Molecular Formula | C19H20Cl2N2O2 |
|---|---|
| Molecular Weight | 379.28000 |
| Exact Mass | 378.09000 |
| PSA | 45.48000 |
| LogP | 4.86740 |
| InChIKey | GUISTZFSXPSDQO-UHFFFAOYSA-N |
| SMILES | Cl.Cl.O=c1cc(N2CCNCC2)oc2c(-c3ccccc3)cccc12 |