2-Chloro-N-isopropyl-5-nitrobenzamide structure
|
Common Name | 2-Chloro-N-isopropyl-5-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 85469-94-9 | Molecular Weight | 242.65900 | |
| Density | 1.297g/cm3 | Boiling Point | 358.3ºC at 760 mmHg | |
| Molecular Formula | C10H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.5ºC | |
| Name | 2-Chloro-N-isopropyl-5-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 358.3ºC at 760 mmHg |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 242.65900 |
| Flash Point | 170.5ºC |
| Exact Mass | 242.04600 |
| PSA | 78.41000 |
| LogP | 3.48440 |
| Index of Refraction | 1.56 |
| InChIKey | YFPMJGHIACIVOS-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)c1cc([N+](=O)[O-])ccc1Cl |
|
~93%
2-Chloro-N-isop... CAS#:85469-94-9 |
| Literature: Henke, Adam; Srogl, Jiri Journal of Organic Chemistry, 2008 , vol. 73, # 19 p. 7783 - 7784 |
| 2-chloro-N'-hydroxyisonicotinimidamide |
| Chlorohydroxyisonicotinamidine |