(2-chloro-4,5-dimethoxyphenyl)-phenylmethanone structure
|
Common Name | (2-chloro-4,5-dimethoxyphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 85525-23-1 | Molecular Weight | 276.71500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-chloro-4,5-dimethoxyphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13ClO3 |
|---|---|
| Molecular Weight | 276.71500 |
| Exact Mass | 276.05500 |
| PSA | 35.53000 |
| LogP | 3.58820 |
| InChIKey | NGZRXYPIQOOTQD-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c(C(=O)c2ccccc2)cc1OC |
|
~%
(2-chloro-4,5-d... CAS#:85525-23-1 |
| Literature: Sato; Dan; Onuma; Tanaka; Aoki; Koga Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 109 - 116 |
|
~%
(2-chloro-4,5-d... CAS#:85525-23-1 |
| Literature: Sato; Dan; Onuma; Tanaka; Aoki; Koga Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 109 - 116 |
| Methanone,(2-chloro-4,5-dimethoxyphenyl)phenyl |
| 2-chloro-4,5-dimethoxybenzophenone |