4-bromo-3-methyl-2-nitro-phenol structure
|
Common Name | 4-bromo-3-methyl-2-nitro-phenol | ||
|---|---|---|---|---|
| CAS Number | 85598-12-5 | Molecular Weight | 232.03100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Bromo-3-methyl-2-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6BrNO3 |
|---|---|
| Molecular Weight | 232.03100 |
| Exact Mass | 230.95300 |
| PSA | 66.05000 |
| LogP | 2.89450 |
| InChIKey | HXNNJFUSAYWUFT-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)ccc(O)c1[N+](=O)[O-] |
| HS Code | 2908999090 |
|---|
|
~99%
4-bromo-3-methy... CAS#:85598-12-5 |
| Literature: BOEHRINGER INGELHEIM INTERNATIONAL GmbH; CARSON, Rebekah J.; FADER, Lee; KAWAI, Stephen; LANDRY, Serge Patent: WO2009/62288 A1, 2009 ; Location in patent: Page/Page column 60-61 ; |
|
~13%
4-bromo-3-methy... CAS#:85598-12-5 |
| Literature: Sumitomo Pharmaceutical Co., Ltd. Patent: US6169107 A, 2001 ; US 6169107 B1 |
|
~%
4-bromo-3-methy... CAS#:85598-12-5 |
| Literature: Yang, Cai-Guang; Wang, Jun; Jiang, Biao Tetrahedron Letters, 2002 , vol. 43, # 6 p. 1063 - 1066 |
|
~%
4-bromo-3-methy... CAS#:85598-12-5 |
| Literature: Gibbs; Robertson Journal of the Chemical Society, 1914 , vol. 105, p. 1891 |
|
~%
4-bromo-3-methy... CAS#:85598-12-5 |
| Literature: Gibbs; Robertson Journal of the Chemical Society, 1914 , vol. 105, p. 1891 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2-Nitro-3-methyl-4-bromophenol |
| 4-Brom-3-methyl-2-nitro-phenol |
| 4-bromo-3-methyl-2-nitro-phenol |
| 6-Brom-2-nitro-3-oxy-toluol |
| 4-Brom-2-nitro-m-kresol |