(1R,2S)-2-(4-bromobenzoyl)cyclohexane-1-carboxylate structure
|
Common Name | (1R,2S)-2-(4-bromobenzoyl)cyclohexane-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 85603-41-4 | Molecular Weight | 311.17100 | |
| Density | N/A | Boiling Point | 465.728ºC at 760 mmHg | |
| Molecular Formula | C14H15BrO3 | Melting Point | 171-175ºC | |
| MSDS | N/A | Flash Point | 235.464ºC | |
| Name | (1R,2S)-2-(4-bromobenzoyl)cyclohexane-1-carboxylate |
|---|
| Boiling Point | 465.728ºC at 760 mmHg |
|---|---|
| Melting Point | 171-175ºC |
| Molecular Formula | C14H15BrO3 |
| Molecular Weight | 311.17100 |
| Flash Point | 235.464ºC |
| Exact Mass | 310.02000 |
| PSA | 54.37000 |
| LogP | 3.52280 |
| InChIKey | OVZXXISOLDHARA-NWDGAFQWSA-M |
| SMILES | O=C([O-])C1CCCCC1C(=O)c1ccc(Br)cc1 |
(1R,2S)-2-(4-br... CAS#:85603-41-4 ~%
(1R,2S)-2-(4-br... CAS#:85603-41-4 |
| Literature: Journal of the American Chemical Society, , vol. 60, p. 2142,2145 |
|
~%
(1R,2S)-2-(4-br... CAS#:85603-41-4 |
| Literature: Journal of the American Chemical Society, , vol. 60, p. 2142,2145 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |