1-methoxy-4-(2-methyl-2-nitropropyl)benzene
1-methoxy-4-(2-methyl-2-nitropropyl)benzene structure
|
Common Name | 1-methoxy-4-(2-methyl-2-nitropropyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 85628-47-3 | Molecular Weight | 209.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methoxy-4-(2-methyl-2-nitropropyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15NO3 |
|---|---|
| Molecular Weight | 209.24200 |
| Exact Mass | 209.10500 |
| PSA | 55.05000 |
| LogP | 2.81620 |
| InChIKey | XOMDMKZXUTVKMM-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(C)(C)[N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~89%
1-methoxy-4-(2-... CAS#:85628-47-3 |
| Literature: Neurochem (International) Limited Patent: US2006/223855 A1, 2006 ; Location in patent: Page/Page column 148 ; |
|
~76%
1-methoxy-4-(2-... CAS#:85628-47-3 |
| Literature: Renger Archiv der Pharmazie, 1983 , vol. 316, # 3 p. 193 - 201 |
|
~%
1-methoxy-4-(2-... CAS#:85628-47-3 |
| Literature: Renger Archiv der Pharmazie, 1983 , vol. 316, # 3 p. 193 - 201 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzene,1-methoxy-4-(2-methyl-2-nitropropyl) |
| 4-Methoxy-(2-methyl-2-nitropropyl)benzol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene? |
| A: Polar surface area (PSA) of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene is 55.05000. |
| Q: What is the English name of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene? |
| A: The English name of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene is 1-methoxy-4-(2-methyl-2-nitropropyl)benzene. |
| Q: What is the molecular weight of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene? |
| A: Molecular weight of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene is 209.24200. |
| Q: What English synonyms does 1-methoxy-4-(2-methyl-2-nitropropyl)benzene have? |
| A: English synonyms of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene: Benzene,1-methoxy-4-(2-methyl-2-nitropropyl), 4-Methoxy-(2-methyl-2-nitropropyl)benzol. |
| Q: What is the CAS number of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene? |
| A: CAS number of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene is 85628-47-3. |
| Q: What is the InChIKey of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene? |
| A: InChIKey of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene is XOMDMKZXUTVKMM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene? |
| A: SMILES notation of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene is COc1ccc(CC(C)(C)[N+](=O)[O-])cc1. |
| Q: What is the LogP of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene? |
| A: LogP of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene is 2.81620. |
| Q: What is the molecular formula of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene? |
| A: Molecular formula of 1-methoxy-4-(2-methyl-2-nitropropyl)benzene is C11H15NO3. |
| Q: What is the Chinese name of 85628-47-3? |
| A: Chinese name of 85628-47-3 is 85628-47-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |