naphthalen-1-yl N,N-diethylcarbamate structure
|
Common Name | naphthalen-1-yl N,N-diethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 85630-39-3 | Molecular Weight | 243.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | naphthalen-1-yl N,N-diethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17NO2 |
|---|---|
| Molecular Weight | 243.30100 |
| Exact Mass | 243.12600 |
| PSA | 29.54000 |
| LogP | 3.68040 |
| InChIKey | PCEIRTKGPDXWOT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)Oc1cccc2ccccc12 |
|
~95%
naphthalen-1-yl... CAS#:85630-39-3 |
| Literature: Jutand, Anny; Mosleh, Adil Journal of Organic Chemistry, 1997 , vol. 62, # 2 p. 261 - 274 |
|
~%
naphthalen-1-yl... CAS#:85630-39-3 |
| Literature: Jutand, Anny; Mosleh, Adil Journal of Organic Chemistry, 1997 , vol. 62, # 2 p. 261 - 274 |
| naphthalen-1-yl diethylcarbamate |
| 1-naphthyl N,N-diethyl-O-carbamate |
| 1-naphthyl N,N-diethylcarbamate |
| Carbamic acid,diethyl-,1-naphthalenyl ester |
| diethyl-carbamic acid-[1]naphthyl ester |
| Diaethyl-carbamidsaeure-[1]naphthylester |
| 1-naphthalenyl diethylcarbamate |
| 1-naphthyl diethylcarbamate |