naphthalen-1-yl N,N-diethylcarbamate
naphthalen-1-yl N,N-diethylcarbamate structure
|
Common Name | naphthalen-1-yl N,N-diethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 85630-39-3 | Molecular Weight | 243.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | naphthalen-1-yl N,N-diethylcarbamate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H17NO2 |
|---|---|
| Molecular Weight | 243.30100 |
| Exact Mass | 243.12600 |
| PSA | 29.54000 |
| LogP | 3.68040 |
| InChIKey | PCEIRTKGPDXWOT-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)Oc1cccc2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~95%
naphthalen-1-yl... CAS#:85630-39-3 |
| Literature: Jutand, Anny; Mosleh, Adil Journal of Organic Chemistry, 1997 , vol. 62, # 2 p. 261 - 274 |
|
~%
naphthalen-1-yl... CAS#:85630-39-3 |
| Literature: Jutand, Anny; Mosleh, Adil Journal of Organic Chemistry, 1997 , vol. 62, # 2 p. 261 - 274 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Potentiation of fenitrothion-induced insecticidal activity against OP-resistant Chilo...
Source: ChEMBL
Target: Chilo suppressalis
External Id: CHEMBL3078274
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| naphthalen-1-yl diethylcarbamate |
| 1-naphthyl N,N-diethyl-O-carbamate |
| 1-naphthyl N,N-diethylcarbamate |
| Carbamic acid,diethyl-,1-naphthalenyl ester |
| diethyl-carbamic acid-[1]naphthyl ester |
| Diaethyl-carbamidsaeure-[1]naphthylester |
| 1-naphthalenyl diethylcarbamate |
| 1-naphthyl diethylcarbamate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of naphthalen-1-yl N,N-diethylcarbamate? |
| A: SMILES notation of naphthalen-1-yl N,N-diethylcarbamate is CCN(CC)C(=O)Oc1cccc2ccccc12. |
| Q: What is the LogP of naphthalen-1-yl N,N-diethylcarbamate? |
| A: LogP of naphthalen-1-yl N,N-diethylcarbamate is 3.68040. |
| Q: What is the molecular weight of naphthalen-1-yl N,N-diethylcarbamate? |
| A: Molecular weight of naphthalen-1-yl N,N-diethylcarbamate is 243.30100. |
| Q: What is the English name of naphthalen-1-yl N,N-diethylcarbamate? |
| A: The English name of naphthalen-1-yl N,N-diethylcarbamate is naphthalen-1-yl N,N-diethylcarbamate. |
| Q: What is the InChIKey of naphthalen-1-yl N,N-diethylcarbamate? |
| A: InChIKey of naphthalen-1-yl N,N-diethylcarbamate is PCEIRTKGPDXWOT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of naphthalen-1-yl N,N-diethylcarbamate? |
| A: Molecular formula of naphthalen-1-yl N,N-diethylcarbamate is C15H17NO2. |
| Q: What English synonyms does naphthalen-1-yl N,N-diethylcarbamate have? |
| A: English synonyms of naphthalen-1-yl N,N-diethylcarbamate: naphthalen-1-yl diethylcarbamate, 1-naphthyl N,N-diethyl-O-carbamate, 1-naphthyl N,N-diethylcarbamate, Carbamic acid,diethyl-,1-naphthalenyl ester, diethyl-carbamic acid-[1]naphthyl ester, Diaethyl-carbamidsaeure-[1]naphthylester, 1-naphthalenyl diethylcarbamate, 1-naphthyl diethylcarbamate. |
| Q: What is the polar surface area (PSA) of naphthalen-1-yl N,N-diethylcarbamate? |
| A: Polar surface area (PSA) of naphthalen-1-yl N,N-diethylcarbamate is 29.54000. |
| Q: What is the CAS number of naphthalen-1-yl N,N-diethylcarbamate? |
| A: CAS number of naphthalen-1-yl N,N-diethylcarbamate is 85630-39-3. |
| Q: What is the Chinese name of 85630-39-3? |
| A: Chinese name of 85630-39-3 is 85630-39-3. |