1-naphthyl triflate structure
|
Common Name | 1-naphthyl triflate | ||
|---|---|---|---|---|
| CAS Number | 99747-74-7 | Molecular Weight | 276.23200 | |
| Density | 1.405 g/mL at 25ºC(lit.) | Boiling Point | 97-98ºC0.3 mm Hg(lit.) | |
| Molecular Formula | C11H7F3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | >230 °F | |
| Name | naphthalen-1-yl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.405 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 97-98ºC0.3 mm Hg(lit.) |
| Molecular Formula | C11H7F3O3S |
| Molecular Weight | 276.23200 |
| Flash Point | >230 °F |
| Exact Mass | 276.00700 |
| PSA | 51.75000 |
| LogP | 4.14900 |
| Appearance of Characters | Liquid | Colorless dark red |
| Index of Refraction | n20/D 1.52(lit.) |
| InChIKey | WQWUQDVFRYMMCY-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1cccc2ccccc12)C(F)(F)F |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S23;S26;S27;S45;S36/S37/S39 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 2906299090 |
|
~98%
1-naphthyl triflate CAS#:99747-74-7 |
| Literature: Piel, Isabel; Steinmetz, Marc; Hirano, Keiichi; Froehlich, Roland; Grimme, Stefan; Glorius, Frank Angewandte Chemie - International Edition, 2011 , vol. 50, # 21 p. 4983 - 4987 |
|
~98%
1-naphthyl triflate CAS#:99747-74-7 |
| Literature: Boisnard, Sabine; Chastanet, Jaqueline; Zhu, Jieping Tetrahedron Letters, 1999 , vol. 40, # 42 p. 7469 - 7472 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-Naphthyl trifluoromethanesulfonate |
| 1-naphthalenyl trifluoromethanesulfonate |
| MFCD00192340 |
| trifluoromethanesulfonic acid naphthalen-1-yl ester |
| trifluoromethanesulfonic ester naphthalene-1-yl ester |
| 1-Naphthyl triflate |
| naphthyl triflate |