3,5-dimethylpyrazole-4-boronic acid, pinacol ester structure
|
Common Name | 3,5-dimethylpyrazole-4-boronic acid, pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 857530-80-4 | Molecular Weight | 222.092 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 364.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H19BN2O2 | Melting Point | 163-168ºC(lit.) | |
| MSDS | N/A | Flash Point | 174.3±27.9 °C | |
| Name | 3,5-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 364.5±42.0 °C at 760 mmHg |
| Melting Point | 163-168ºC(lit.) |
| Molecular Formula | C11H19BN2O2 |
| Molecular Weight | 222.092 |
| Flash Point | 174.3±27.9 °C |
| Exact Mass | 222.153961 |
| PSA | 47.14000 |
| LogP | 1.32570 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | GNUDAJTUCJEBEI-UHFFFAOYSA-N |
| SMILES | Cc1n[nH]c(C)c1B1OC(C)(C)C(C)(C)O1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | 26 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
|
~59%
3,5-dimethylpyr... CAS#:857530-80-4 |
| Literature: Larsen, Matthew A.; Hartwig, John F. Journal of the American Chemical Society, 2014 , vol. 136, # 11 p. 4287 - 4299 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole |
| 1H-Pyrazole, 3,5-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- |