2-(4-chlorophenyl)-2-(4-iodophenyl)oxirane structure
|
Common Name | 2-(4-chlorophenyl)-2-(4-iodophenyl)oxirane | ||
|---|---|---|---|---|
| CAS Number | 857532-00-4 | Molecular Weight | 356.58600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10ClIO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)-2-(4-iodophenyl)oxirane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10ClIO |
|---|---|
| Molecular Weight | 356.58600 |
| Exact Mass | 355.94600 |
| PSA | 12.53000 |
| LogP | 4.21840 |
| InChIKey | WXMLRJXLEVSVPI-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C2(c3ccc(I)cc3)CO2)cc1 |
|
~97%
2-(4-chlorophen... CAS#:857532-00-4 |
| Literature: ASTEX THERAPEUTICS LIMITED; THE INSTITUTE OF CANCER RESEARCH:ROYAL CANCER HOSPITAL; CANCER RESEARCH TECHNOLOGY LIMITED; ASTRAZENECA AB Patent: WO2008/110846 A2, 2008 ; Location in patent: Page/Page column 45; 47; 89-90 ; WO 2008/110846 A2 |
| Oxirane,2-(4-chlorophenyl)-2-(4-iodophenyl) |
| (RS)-2-(4-chloro-phenyl)-2-(4-iodo-phenyl)-oxirane |