2-(4-chlorophenyl)-2-(4-iodophenyl)morpholine structure
|
Common Name | 2-(4-chlorophenyl)-2-(4-iodophenyl)morpholine | ||
|---|---|---|---|---|
| CAS Number | 857532-02-6 | Molecular Weight | 399.65400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15ClINO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-chlorophenyl)-2-(4-iodophenyl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15ClINO |
|---|---|
| Molecular Weight | 399.65400 |
| Exact Mass | 398.98900 |
| PSA | 21.26000 |
| LogP | 4.13680 |
| InChIKey | XMRGJITVFDERNT-UHFFFAOYSA-N |
| SMILES | Clc1ccc(C2(c3ccc(I)cc3)CNCCO2)cc1 |
|
~43%
2-(4-chlorophen... CAS#:857532-02-6 |
| Literature: ASTEX THERAPEUTICS LIMITED; THE INSTITUTE OF CANCER RESEARCH: ROYAL CANCER HOSPITAL; CANCER RESEARCH TECHNOLOGY LIMITED Patent: WO2006/136821 A1, 2006 ; Location in patent: Page/Page column 131 ; WO 2006/136821 A1 |
| 2-(4-chloro-phenyl)-2-(4-iodo-phenyl)-morpholine |
| Morpholine,2-(4-chlorophenyl)-2-(4-iodophenyl) |