11,12-Di-O-acetyltenacigenin B structure
|
Common Name | 11,12-Di-O-acetyltenacigenin B | ||
|---|---|---|---|---|
| CAS Number | 857897-01-9 | Molecular Weight | 448.55 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 554.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C25H36O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.6±23.6 °C | |
Use of 11,12-Di-O-acetyltenacigenin B11α,12β-Di-O-acetyltenacigenin B is a polyoxypregnane compound isolated from the CHCl(3)-soluble fraction of the ethanolic extract of the stem of Marsdenia tenacissima[1]. |
| Name | (2S)-2-[2-(2-Methoxyethoxy)ethoxy]-1-propanol |
|---|---|
| Synonym | More Synonyms |
| Description | 11α,12β-Di-O-acetyltenacigenin B is a polyoxypregnane compound isolated from the CHCl(3)-soluble fraction of the ethanolic extract of the stem of Marsdenia tenacissima[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 554.2±50.0 °C at 760 mmHg |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.55 |
| Flash Point | 181.6±23.6 °C |
| Exact Mass | 448.246094 |
| PSA | 102.43000 |
| LogP | 1.94 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | MIGQPMYRGFABCC-FXEFVYADSA-N |
| SMILES | CC(=O)OC1C2C3(C)CCC(O)CC3CCC23OC32CCC(C(C)=O)C2(C)C1OC(C)=O |
| Hazard Codes | Xi |
|---|
| (3β,5α,11α,12β,14β,17α)-3-Hydroxy-20-oxo-8,14-epoxypregnane-11,12-diyl diacetate |
| Pregnan-20-one, 11,12-bis(acetyloxy)-8,14-epoxy-3-hydroxy-, (3β,5α,11α,12β,14β,17α)- |