6-Methoxy-2-phenylpyrimidine-4-carboxylic acid structure
|
Common Name | 6-Methoxy-2-phenylpyrimidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 85815-04-9 | Molecular Weight | 230.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-Methoxy-2-phenylpyrimidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10N2O3 |
|---|---|
| Molecular Weight | 230.21900 |
| Exact Mass | 230.06900 |
| PSA | 72.31000 |
| LogP | 1.85040 |
| InChIKey | UXPFEVPQMWWLCL-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)nc(-c2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
|
~26%
6-Methoxy-2-phe... CAS#:85815-04-9 |
| Literature: Honma; Sekine; Hashiyama; Takeda; Ono; Tsuzurahara Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 12 p. 4314 - 4324 |
|
~%
6-Methoxy-2-phe... CAS#:85815-04-9 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 30, # 12 p. 4314 - 4324 |
|
~%
6-Methoxy-2-phe... CAS#:85815-04-9 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 30, # 12 p. 4314 - 4324 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| GE-0701 |
| methoxyphenylpyrimidinecarboxylicacid |
| 4-methoxy-2-phenylpyrimidine-6-carboxylic acid |