phenylsulfonyl-l-serine structure
|
Common Name | phenylsulfonyl-l-serine | ||
|---|---|---|---|---|
| CAS Number | 85828-29-1 | Molecular Weight | 245.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenylsulfonyl-l-serine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11NO5S |
|---|---|
| Molecular Weight | 245.25200 |
| Exact Mass | 245.03600 |
| PSA | 112.08000 |
| LogP | 0.88210 |
| InChIKey | WQVIJBXPLXLSCI-QMMMGPOBSA-N |
| SMILES | O=C(O)C(CO)NS(=O)(=O)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~71%
phenylsulfonyl-... CAS#:85828-29-1 |
| Literature: Maurer; Takahata; Rapoport Journal of the American Chemical Society, 1984 , vol. 106, # 4 p. 1095 - 1098 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-benzenesulfonyl-L-serine |