3-[(3,4-dimethylphenyl)carbamoyl]prop-2-enoic acid structure
|
Common Name | 3-[(3,4-dimethylphenyl)carbamoyl]prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 85843-38-5 | Molecular Weight | 219.23700 | |
| Density | 1.243g/cm3 | Boiling Point | 454.7ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8ºC | |
| Name | (E)-4-((3,4-dimethylphenyl)amino)-4-oxobut-2-enoic acid |
|---|
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 454.7ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 228.8ºC |
| Exact Mass | 219.09000 |
| PSA | 66.40000 |
| LogP | 1.95570 |
| Index of Refraction | 1.609 |
| InChIKey | BKCZXPVWUVICKC-WAYWQWQTSA-N |
| SMILES | Cc1ccc(NC(=O)C=CC(=O)O)cc1C |
| HS Code | 2924299090 |
|---|
|
~91%
3-[(3,4-dimethy... CAS#:85843-38-5 |
| Literature: Jha, Amitabh; Dimmock, Jonathan R. Synthetic Communications, 2003 , vol. 33, # 7 p. 1211 - 1223 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |