bis(2-ethyloctyl) phthalate structure
|
Common Name | bis(2-ethyloctyl) phthalate | ||
|---|---|---|---|---|
| CAS Number | 85851-81-6 | Molecular Weight | 446.66200 | |
| Density | 0.964g/cm3 | Boiling Point | 425.8ºC at 760 mmHg | |
| Molecular Formula | C28H46O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.6ºC | |
| Name | bis(2-ethyloctyl) benzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.964g/cm3 |
|---|---|
| Boiling Point | 425.8ºC at 760 mmHg |
| Molecular Formula | C28H46O4 |
| Molecular Weight | 446.66200 |
| Flash Point | 227.6ºC |
| Exact Mass | 446.34000 |
| PSA | 52.60000 |
| LogP | 7.99340 |
| Index of Refraction | 1.486 |
| InChIKey | ORKHXMGDPOGDKE-UHFFFAOYSA-N |
| SMILES | CCCCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCCCC |
| HS Code | 2917349000 |
|---|
| HS Code | 2917349000 |
|---|---|
| Summary | 2917349000 other esters of orthophthalic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 288-640-9 |
| Bis(2-ethyloctyl) phthalate |
| 1,2-Benzenedicarboxylicacid,bis(2-ethyloctyl) ester (9CI) |
| 1,2-Benzenedicarboxylicacid,1,2-bis(2-ethyloctyl) ester |