4-Methyl-indole-3-carboxylic acid structure
|
Common Name | 4-Methyl-indole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 858515-65-8 | Molecular Weight | 175.18400 | |
| Density | 1.34g/cm3 | Boiling Point | 419.9ºC at 760 mmHg | |
| Molecular Formula | C10H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.8ºC | |
| Name | 4-Methyl-1H-indole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 419.9ºC at 760 mmHg |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.18400 |
| Flash Point | 207.8ºC |
| Exact Mass | 175.06300 |
| PSA | 53.09000 |
| LogP | 2.17450 |
| Index of Refraction | 1.696 |
| InChIKey | ADKWDRQMDHFTJP-UHFFFAOYSA-N |
| SMILES | Cc1cccc2[nH]cc(C(=O)O)c12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
4-Methyl-indole... CAS#:858515-65-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 11 p. 2734 - 2737 |
|
~%
4-Methyl-indole... CAS#:858515-65-8 |
| Literature: Chemische Berichte, , vol. 62, p. 2879 |
|
~%
4-Methyl-indole... CAS#:858515-65-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 11 p. 2734 - 2737 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methyl-1H-indole-3-carboxylic acid |