Moveltipril structure
|
Common Name | Moveltipril | ||
|---|---|---|---|---|
| CAS Number | 85856-54-8 | Molecular Weight | 398.51700 | |
| Density | 1.248g/cm3 | Boiling Point | 658.9ºC at 760 mmHg | |
| Molecular Formula | C19H30N2O5S | Melting Point | 113-116° | |
| MSDS | N/A | Flash Point | 352.3ºC | |
Use of MoveltiprilMoveltipril is a potent angiotensin converting enzyme (ACE) inhibitor[1]. |
| Name | (2S)-1-[(2S)-3-[(2R)-2-(cyclohexanecarbonylamino)propanoyl]sulfanyl-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Moveltipril is a potent angiotensin converting enzyme (ACE) inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. A Salvetti, et al. Newer ACE inhibitors. A look at the future. |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 658.9ºC at 760 mmHg |
| Melting Point | 113-116° |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.51700 |
| Flash Point | 352.3ºC |
| Exact Mass | 398.18800 |
| PSA | 129.08000 |
| LogP | 2.37170 |
| Index of Refraction | 1.553 |
| InChIKey | QIJLJZOGPPQCOG-NFAWXSAZSA-N |
| SMILES | CC(CSC(=O)C(C)NC(=O)C1CCCCC1)C(=O)N1CCCC1C(=O)O |
| Moveltipril |
| Altiopril |