BW A-533U structure
|
Common Name | BW A-533U | ||
|---|---|---|---|---|
| CAS Number | 85872-58-8 | Molecular Weight | 300.26900 | |
| Density | 1.495g/cm3 | Boiling Point | 621.9ºC at 760 mmHg | |
| Molecular Formula | C14H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.9ºC | |
| Name | 4-(1,3-dimethyl-2,6-dioxo-7H-purin-8-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.495g/cm3 |
|---|---|
| Boiling Point | 621.9ºC at 760 mmHg |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.26900 |
| Flash Point | 329.9ºC |
| Exact Mass | 300.08600 |
| PSA | 109.98000 |
| LogP | 0.32550 |
| Index of Refraction | 1.666 |
| InChIKey | VOGIMZNURUXDIJ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(-c3ccc(C(=O)O)cc3)nc2n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(1,3-dimethyl-2,6-dioxo-1H-purin-8-yl)benzoic acid |
| Benzoic acid,4-(2,3,6,7-tetrahydro-1,3-dimethyl-2,6-dioxo-1H-purin-8-yl) |
| 4-(1,3-dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)-benzoic acid |
| 4-(1,3-Dimethyl-2,6-dioxo-2,3,6,7-tetrahydro-1H-purin-8-yl)-benzoesaeure |
| 8-(4-carboxyphenyl)-1,3-dimethyl-3,7-dihydropurin-2,6-dione |
| BW A533U |