N-Benzyl-N,N-diethylethanaminium tetrahydroborate structure
|
Common Name | N-Benzyl-N,N-diethylethanaminium tetrahydroborate | ||
|---|---|---|---|---|
| CAS Number | 85874-45-9 | Molecular Weight | 207.163 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25BN | Melting Point | 146ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Benzyl-N,N-diethylethanaminium tetrahydroborateBenzyltriethylammonium Borohydride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | benzyltriethylammonium borohydride |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyltriethylammonium Borohydride is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Melting Point | 146ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C13H25BN |
| Molecular Weight | 207.163 |
| Exact Mass | 207.215836 |
| LogP | 1.87920 |
| InChIKey | HQGWCEJYXHFBSA-UHFFFAOYSA-N |
| SMILES | CC[N+](CC)(CC)Cc1ccccc1.[B-] |
| Hazard Codes | F,C |
|---|---|
| Risk Phrases | 15-34 |
| Safety Phrases | 26-36/37/39-43-45-27 |
| RIDADR | UN 3131 4.3/PG 2 |
| Hazard Class | 4.3 |
| HS Code | 2923900090 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-Benzyl-N,N-diethylethanaminium tetrahydroborate |
| N,N,N-Triethyl-benzeneMethanaMiniuM Tetrahydroborate |
| benzyltriethylammonium tetrahydridoborate |
| N,N,N-Triethylbenzenemethanaminium tetrahydroborate(1-) |
| BENZYLTRIETHYLAMMONIUM TETRAHYDROBORATE |
| MFCD00191785 |